C10H14N2O2S — CID 63037738
(2,6-dimethylmorpholin-4-yl)-(1,3-thiazol-4-yl)methanone (PubChem CID 63037738) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(1,3-thiazol-4-yl)methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 63037738 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(1,3-thiazol-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cscn2)CC(C)O1 |
| InChI | InChI=1S/C10H14N2O2S/c1-7-3-12(4-8(2)14-7)10(13)9-5-15-6-11-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | NGASLJWTGCQXNK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |