C12H16N2O3S — CID 78926012
N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3-thiazole-4-carboxamide (PubChem CID 78926012) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 78926012 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)c1cscn1 |
| InChI | InChI=1S/C12H16N2O3S/c15-11(10-7-18-8-13-10)14-9-1-3-12(4-2-9)16-5-6-17-12/h7-9H,1-6H2,(H,14,15) |
| InChIKey | ZOJZQCQRFKTGHT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |