C15H18FNO3 — CID 112729579
N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzamide (PubChem CID 112729579) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 112729579 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzamide |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)c1ccccc1F |
| InChI | InChI=1S/C15H18FNO3/c16-13-4-2-1-3-12(13)14(18)17-11-5-7-15(8-6-11)19-9-10-20-15/h1-4,11H,5-10H2,(H,17,18) |
| InChIKey | UNAJAISOTKNOSI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |