C15H17ClFNO3 — CID 81422797
3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-4-fluorobenzamide (PubChem CID 81422797) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-4-fluorobenzamide.
| Compound Name | 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 81422797 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-chloro-N-(1,4-dioxaspiro[4.5]decan-8-yl)-4-fluorobenzamide |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClFNO3/c16-12-9-10(1-2-13(12)17)14(19)18-11-3-5-15(6-4-11)20-7-8-21-15/h1-2,9,11H,3-8H2,(H,18,19) |
| InChIKey | NIKJFMYHRSZKIS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |