C15H19NO4 — CID 47249822
N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-hydroxybenzamide (PubChem CID 47249822) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-hydroxybenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 47249822 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-hydroxybenzamide |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)c1ccccc1O |
| InChI | InChI=1S/C15H19NO4/c17-13-4-2-1-3-12(13)14(18)16-11-5-7-15(8-6-11)19-9-10-20-15/h1-4,11,17H,5-10H2,(H,16,18) |
| InChIKey | OTKKFMQGYLBGTL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |