C15H18FNO4 — CID 104916913
N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluoro-6-hydroxybenzamide (PubChem CID 104916913) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 104916913 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluoro-6-hydroxybenzamide |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)c1c(O)cccc1F |
| InChI | InChI=1S/C15H18FNO4/c16-11-2-1-3-12(18)13(11)14(19)17-10-4-6-15(7-5-10)20-8-9-21-15/h1-3,10,18H,4-9H2,(H,17,19) |
| InChIKey | NHHPNSWWOAUZFA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |