C16H20FNO3 — CID 112729639
N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-fluoro-2-methylbenzamide (PubChem CID 112729639) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-fluoro-2-methylbenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 112729639 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-fluoro-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H20FNO3/c1-11-2-3-12(17)10-14(11)15(19)18-13-4-6-16(7-5-13)20-8-9-21-16/h2-3,10,13H,4-9H2,1H3,(H,18,19) |
| InChIKey | KELKGSDWQYUEPI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |