C13H15ClFNO2 — CID 114631205
3-chloro-4-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide (PubChem CID 114631205) has the molecular formula C13H15ClFNO2 and a molecular weight of 271.72 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide.
| Compound Name | 3-chloro-4-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 114631205 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-chloro-4-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFNO2/c1-13(2)10(6-11(13)17)16-12(18)7-3-4-9(15)8(14)5-7/h3-5,10-11,17H,6H2,1-2H3,(H,16,18) |
| InChIKey | JIVKRNUKMDVOTD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |