C12H15ClN2O2 — CID 114629337
6-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide (PubChem CID 114629337) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 6-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114629337 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 6-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H15ClN2O2/c1-12(2)8(5-9(12)16)15-11(17)7-3-4-10(13)14-6-7/h3-4,6,8-9,16H,5H2,1-2H3,(H,15,17) |
| InChIKey | JSYBBGLCBPLXCK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|