C12H15NO4 — CID 114631311
N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-oxopyran-3-carboxamide (PubChem CID 114631311) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-oxopyran-3-carboxamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 114631311 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-oxopyran-3-carboxamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1ccc(=O)oc1 |
| InChI | InChI=1S/C12H15NO4/c1-12(2)8(5-9(12)14)13-11(16)7-3-4-10(15)17-6-7/h3-4,6,8-9,14H,5H2,1-2H3,(H,13,16) |
| InChIKey | DOBOOXDGGRQDNZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |