C10H12N2O3 — CID 43594945
N-(3-aminocyclobutyl)-6-oxopyran-3-carboxamide (PubChem CID 43594945) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-6-oxopyran-3-carboxamide.
| Compound Name | N-(3-aminocyclobutyl)-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 43594945 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(3-aminocyclobutyl)-6-oxopyran-3-carboxamide |
| SMILES | NC1CC(NC(=O)c2ccc(=O)oc2)C1 |
| InChI | InChI=1S/C10H12N2O3/c11-7-3-8(4-7)12-10(14)6-1-2-9(13)15-5-6/h1-2,5,7-8H,3-4,11H2,(H,12,14) |
| InChIKey | WRLPHARCDMEQMT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |