C14H18ClNO2 — CID 114631389
4-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbenzamide (PubChem CID 114631389) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbenzamide.
| Compound Name | 4-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 114631389 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CC(O)C2(C)C)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-8-6-9(4-5-10(8)15)13(18)16-11-7-12(17)14(11,2)3/h4-6,11-12,17H,7H2,1-3H3,(H,16,18) |
| InChIKey | VQGMSPGWRMBLKN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |