C13H14Cl2INO2 — CID 114630703
3,5-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-iodobenzamide (PubChem CID 114630703) has the molecular formula C13H14Cl2INO2 and a molecular weight of 414.07 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 114630703 |
| Molecular Formula | C13H14Cl2INO2 |
| Molecular Weight | 414.07 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 3,5-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-iodobenzamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C13H14Cl2INO2/c1-13(2)9(5-10(13)18)17-12(19)7-3-6(14)4-8(15)11(7)16/h3-4,9-10,18H,5H2,1-2H3,(H,17,19) |
| InChIKey | CRWXHGUWCLYFSG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.07 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|