About 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide
2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide (PubChem CID 114630704) has the molecular formula C13H15I2NO3
and a molecular weight of 487.08 g/mol. Its IUPAC name is 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide |
| PubChem CID | 114630704 |
| Molecular Formula | C13H15I2NO3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.91 |
| IUPAC Name | 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C13H15I2NO3/c1-13(2)9(5-10(13)17)16-12(19)7-3-6(14)4-8(15)11(7)18/h3-4,9-10,17-18H,5H2,1-2H3,(H,16,19) |
| InChIKey | LQZPRAVXKWFUSE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide?
The IUPAC name of 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide (CID 114630704) is 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide.
What is the SMILES notation for 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide?
The canonical SMILES for 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide is CC1(C)C(O)CC1NC(=O)c1cc(I)cc(I)c1O.
What is the InChIKey of 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide?
The InChIKey is LQZPRAVXKWFUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15I2NO3/c1-13(2)9(5-10(13)17)16-12(19)7-3-6(14)4-8(15)11(7)18/h3-4,9-10,17-18H,5H2,1-2H3,(H,16,19).
What are the key properties of 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide?
2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide has a molecular weight of 487.08 g/mol, XLogP of 2.49, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(3-hydroxy-2,2-dimethylcyclobutyl)-3,5-diiodobenzamide is sourced from PubChem (CID 114630704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).