C13H15I2NO3 — CID 43388711
2-hydroxy-N-(4-hydroxycyclohexyl)-3,5-diiodobenzamide (PubChem CID 43388711) has the molecular formula C13H15I2NO3 and a molecular weight of 487.08 g/mol. Its IUPAC name is 2-hydroxy-N-(4-hydroxycyclohexyl)-3,5-diiodobenzamide.
| Compound Name | 2-hydroxy-N-(4-hydroxycyclohexyl)-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 43388711 |
| Molecular Formula | C13H15I2NO3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.91 |
| IUPAC Name | 2-hydroxy-N-(4-hydroxycyclohexyl)-3,5-diiodobenzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C13H15I2NO3/c14-7-5-10(12(18)11(15)6-7)13(19)16-8-1-3-9(17)4-2-8/h5-6,8-9,17-18H,1-4H2,(H,16,19) |
| InChIKey | CERXTDMOZVXAJL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|