C12H12I3NO — CID 60631264
N-cyclopentyl-2,3,5-triiodobenzamide (PubChem CID 60631264) has the molecular formula C12H12I3NO and a molecular weight of 566.95 g/mol. Its IUPAC name is N-cyclopentyl-2,3,5-triiodobenzamide.
| Compound Name | N-cyclopentyl-2,3,5-triiodobenzamide |
|---|---|
| PubChem CID | 60631264 |
| Molecular Formula | C12H12I3NO |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.81 |
| IUPAC Name | N-cyclopentyl-2,3,5-triiodobenzamide |
| SMILES | O=C(NC1CCCC1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C12H12I3NO/c13-7-5-9(11(15)10(14)6-7)12(17)16-8-3-1-2-4-8/h5-6,8H,1-4H2,(H,16,17) |
| InChIKey | RSWYWEOMYOLFNK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|