C18H26N4O2 — CID 131994880
4-N,6-N-dicyclohexylpyrimidine-4,6-dicarboxamide (PubChem CID 131994880) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-N,6-N-dicyclohexylpyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-dicyclohexylpyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 131994880 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-N,6-N-dicyclohexylpyrimidine-4,6-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(C(=O)NC2CCCCC2)ncn1 |
| InChI | InChI=1S/C18H26N4O2/c23-17(21-13-7-3-1-4-8-13)15-11-16(20-12-19-15)18(24)22-14-9-5-2-6-10-14/h11-14H,1-10H2,(H,21,23)(H,22,24) |
| InChIKey | MJYPJFZQRJATTG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |