C17H26N4O — CID 109341807
N-cyclohexyl-6-(cyclohexylamino)pyrimidine-4-carboxamide (PubChem CID 109341807) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-cyclohexyl-6-(cyclohexylamino)pyrimidine-4-carboxamide.
| Compound Name | N-cyclohexyl-6-(cyclohexylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109341807 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-cyclohexyl-6-(cyclohexylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NC2CCCCC2)ncn1 |
| InChI | InChI=1S/C17H26N4O/c22-17(21-14-9-5-2-6-10-14)15-11-16(19-12-18-15)20-13-7-3-1-4-8-13/h11-14H,1-10H2,(H,21,22)(H,18,19,20) |
| InChIKey | IYJWDZFWCNNKIA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |