C8H5I3O — CID 66827286
1-(2,3,5-triiodophenyl)ethanone (PubChem CID 66827286) has the molecular formula C8H5I3O and a molecular weight of 497.84 g/mol. Its IUPAC name is 1-(2,3,5-triiodophenyl)ethanone.
| Compound Name | 1-(2,3,5-triiodophenyl)ethanone |
|---|---|
| PubChem CID | 66827286 |
| Molecular Formula | C8H5I3O |
| Molecular Weight | 497.84 g/mol |
| Exact Mass | 497.75 |
| IUPAC Name | 1-(2,3,5-triiodophenyl)ethanone |
| SMILES | CC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C8H5I3O/c1-4(12)6-2-5(9)3-7(10)8(6)11/h2-3H,1H3 |
| InChIKey | CNRDQCFINAFYRU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|