2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid

C14H16I3NO3 — CID 65261315

IUPAC2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid
SMILESCC(C)(NC(=O)c1cc(I)cc(I)c1I)C(C)(C)C(=O)O
InChIInChI=1S/C14H16I3NO3/c1-13(2,12(20)21)14(3,4)18-11(19)8-5-7(15)6-9(16)10(8)17/h5-6H,1-4H3,(H,18,19)(H,20,21)
InChIKeyFZMVAJIKJYVHKS-UHFFFAOYSA-N
MW627.00 g/mol
LogP4.12
Rot. Bonds4

About 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid

2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid (PubChem CID 65261315) has the molecular formula C14H16I3NO3 and a molecular weight of 627.00 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid.

Molecular Properties

Compound Name2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid
PubChem CID65261315
Molecular FormulaC14H16I3NO3
Molecular Weight627.00 g/mol
Exact Mass626.83
IUPAC Name2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid
SMILESCC(C)(NC(=O)c1cc(I)cc(I)c1I)C(C)(C)C(=O)O
InChIInChI=1S/C14H16I3NO3/c1-13(2,12(20)21)14(3,4)18-11(19)8-5-7(15)6-9(16)10(8)17/h5-6H,1-4H3,(H,18,19)(H,20,21)
InChIKeyFZMVAJIKJYVHKS-UHFFFAOYSA-N
XLogP4.12
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500627.00
LogP ≤ 54.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid?
The IUPAC name of 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid (CID 65261315) is 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid.
What is the SMILES notation for 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid?
The canonical SMILES for 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid is CC(C)(NC(=O)c1cc(I)cc(I)c1I)C(C)(C)C(=O)O.
What is the InChIKey of 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid?
The InChIKey is FZMVAJIKJYVHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16I3NO3/c1-13(2,12(20)21)14(3,4)18-11(19)8-5-7(15)6-9(16)10(8)17/h5-6H,1-4H3,(H,18,19)(H,20,21).
What are the key properties of 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid?
2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid has a molecular weight of 627.00 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trimethyl-3-[(2,3,5-triiodobenzoyl)amino]butanoic acid is sourced from PubChem (CID 65261315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).