C10H8I3NO4 — CID 63404701
(2S)-3-hydroxy-2-[(2,3,5-triiodobenzoyl)amino]propanoic acid (PubChem CID 63404701) has the molecular formula C10H8I3NO4 and a molecular weight of 586.89 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(2,3,5-triiodobenzoyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[(2,3,5-triiodobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 63404701 |
| Molecular Formula | C10H8I3NO4 |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.76 |
| IUPAC Name | (2S)-3-hydroxy-2-[(2,3,5-triiodobenzoyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](CO)C(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H8I3NO4/c11-4-1-5(8(13)6(12)2-4)9(16)14-7(3-15)10(17)18/h1-2,7,15H,3H2,(H,14,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | YJQPVQOYQHKPJF-ZETCQYMHSA-N |
| XLogP | 1.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|