C10H9BrINO4 — CID 80747894
(2R)-2-[(5-bromo-2-iodobenzoyl)amino]-3-hydroxypropanoic acid (PubChem CID 80747894) has the molecular formula C10H9BrINO4 and a molecular weight of 413.99 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-2-iodobenzoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(5-bromo-2-iodobenzoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80747894 |
| Molecular Formula | C10H9BrINO4 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 412.88 |
| IUPAC Name | (2R)-2-[(5-bromo-2-iodobenzoyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(N[C@H](CO)C(=O)O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C10H9BrINO4/c11-5-1-2-7(12)6(3-5)9(15)13-8(4-14)10(16)17/h1-3,8,14H,4H2,(H,13,15)(H,16,17)/t8-/m1/s1 |
| InChIKey | SNOQHGLDWCWYCU-MRVPVSSYSA-N |
| XLogP | 1.23 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|