C10H9BrFNO4 — CID 24690745
2-[(4-bromo-2-fluorobenzoyl)amino]-3-hydroxypropanoic acid (PubChem CID 24690745) has the molecular formula C10H9BrFNO4 and a molecular weight of 306.09 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorobenzoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(4-bromo-2-fluorobenzoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 24690745 |
| Molecular Formula | C10H9BrFNO4 |
| Molecular Weight | 306.09 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-[(4-bromo-2-fluorobenzoyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H9BrFNO4/c11-5-1-2-6(7(12)3-5)9(15)13-8(4-14)10(16)17/h1-3,8,14H,4H2,(H,13,15)(H,16,17) |
| InChIKey | GMWOLAOTBIUCSA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.09 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |