C10H7F4NO4 — CID 80749154
(2R)-3-hydroxy-2-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoic acid (PubChem CID 80749154) has the molecular formula C10H7F4NO4 and a molecular weight of 281.16 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 80749154 |
| Molecular Formula | C10H7F4NO4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | (2R)-3-hydroxy-2-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoic acid |
| SMILES | O=C(N[C@H](CO)C(=O)O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F4NO4/c11-4-1-3(6(12)8(14)7(4)13)9(17)15-5(2-16)10(18)19/h1,5,16H,2H2,(H,15,17)(H,18,19)/t5-/m1/s1 |
| InChIKey | OVJGDEZOAKFWLM-RXMQYKEDSA-N |
| XLogP | 0.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|