C12H13F4NO2S — CID 103867152
2,3,4,5-tetrafluoro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzamide (PubChem CID 103867152) has the molecular formula C12H13F4NO2S and a molecular weight of 311.30 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 103867152 |
| Molecular Formula | C12H13F4NO2S |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzamide |
| SMILES | CSC(CO)C(C)NC(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F4NO2S/c1-5(8(4-18)20-2)17-12(19)6-3-7(13)10(15)11(16)9(6)14/h3,5,8,18H,4H2,1-2H3,(H,17,19) |
| InChIKey | OIFFEKBBQLYNDE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|