C11H7F4NO5 — CID 78910205
2-[(2,3,4,5-tetrafluorobenzoyl)amino]butanedioic acid (PubChem CID 78910205) has the molecular formula C11H7F4NO5 and a molecular weight of 309.17 g/mol. Its IUPAC name is 2-[(2,3,4,5-tetrafluorobenzoyl)amino]butanedioic acid.
| Compound Name | 2-[(2,3,4,5-tetrafluorobenzoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 78910205 |
| Molecular Formula | C11H7F4NO5 |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-[(2,3,4,5-tetrafluorobenzoyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1cc(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C11H7F4NO5/c12-4-1-3(7(13)9(15)8(4)14)10(19)16-5(11(20)21)2-6(17)18/h1,5H,2H2,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | QOGBRJZRIUJAGZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|