C11H9BrFNO5 — CID 107949396
(2S)-2-[(3-bromo-4-fluorobenzoyl)amino]butanedioic acid (PubChem CID 107949396) has the molecular formula C11H9BrFNO5 and a molecular weight of 334.10 g/mol. Its IUPAC name is (2S)-2-[(3-bromo-4-fluorobenzoyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(3-bromo-4-fluorobenzoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 107949396 |
| Molecular Formula | C11H9BrFNO5 |
| Molecular Weight | 334.10 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | (2S)-2-[(3-bromo-4-fluorobenzoyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccc(F)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C11H9BrFNO5/c12-6-3-5(1-2-7(6)13)10(17)14-8(11(18)19)4-9(15)16/h1-3,8H,4H2,(H,14,17)(H,15,16)(H,18,19)/t8-/m0/s1 |
| InChIKey | OOBWBROGLOPCSA-QMMMGPOBSA-N |
| XLogP | 1.25 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.10 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |