2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid

C9H7Cl2NO5S — CID 114020996

IUPAC2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid
SMILESO=C(O)CC(NC(=O)c1cc(Cl)sc1Cl)C(=O)O
InChIInChI=1S/C9H7Cl2NO5S/c10-5-1-3(7(11)18-5)8(15)12-4(9(16)17)2-6(13)14/h1,4H,2H2,(H,12,15)(H,13,14)(H,16,17)
InChIKeyYCPFLLPBGWEDCE-UHFFFAOYSA-N
MW312.13 g/mol
LogP1.71
Rot. Bonds5

About 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid

2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid (PubChem CID 114020996) has the molecular formula C9H7Cl2NO5S and a molecular weight of 312.13 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid.

Molecular Properties

Compound Name2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid
PubChem CID114020996
Molecular FormulaC9H7Cl2NO5S
Molecular Weight312.13 g/mol
Exact Mass310.94
IUPAC Name2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid
SMILESO=C(O)CC(NC(=O)c1cc(Cl)sc1Cl)C(=O)O
InChIInChI=1S/C9H7Cl2NO5S/c10-5-1-3(7(11)18-5)8(15)12-4(9(16)17)2-6(13)14/h1,4H,2H2,(H,12,15)(H,13,14)(H,16,17)
InChIKeyYCPFLLPBGWEDCE-UHFFFAOYSA-N
XLogP1.71
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.13
LogP ≤ 51.71
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid?
The IUPAC name of 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid (CID 114020996) is 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid.
What is the SMILES notation for 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid?
The canonical SMILES for 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid is O=C(O)CC(NC(=O)c1cc(Cl)sc1Cl)C(=O)O.
What is the InChIKey of 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid?
The InChIKey is YCPFLLPBGWEDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO5S/c10-5-1-3(7(11)18-5)8(15)12-4(9(16)17)2-6(13)14/h1,4H,2H2,(H,12,15)(H,13,14)(H,16,17).
What are the key properties of 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid?
2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid has a molecular weight of 312.13 g/mol, XLogP of 1.71, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid is sourced from PubChem (CID 114020996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).