C9H7Cl2NO5S — CID 114020996
2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid (PubChem CID 114020996) has the molecular formula C9H7Cl2NO5S and a molecular weight of 312.13 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid.
| Compound Name | 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 114020996 |
| Molecular Formula | C9H7Cl2NO5S |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 310.94 |
| IUPAC Name | 2-[(2,5-dichlorothiophene-3-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1cc(Cl)sc1Cl)C(=O)O |
| InChI | InChI=1S/C9H7Cl2NO5S/c10-5-1-3(7(11)18-5)8(15)12-4(9(16)17)2-6(13)14/h1,4H,2H2,(H,12,15)(H,13,14)(H,16,17) |
| InChIKey | YCPFLLPBGWEDCE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |