C8H7Cl2NO3S — CID 106702681
(2S)-2-amino-4-(2,5-dichlorothiophen-3-yl)-4-oxobutanoic acid (PubChem CID 106702681) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is (2S)-2-amino-4-(2,5-dichlorothiophen-3-yl)-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-(2,5-dichlorothiophen-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106702681 |
| Molecular Formula | C8H7Cl2NO3S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | (2S)-2-amino-4-(2,5-dichlorothiophen-3-yl)-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)c1cc(Cl)sc1Cl)C(=O)O |
| InChI | InChI=1S/C8H7Cl2NO3S/c9-6-1-3(7(10)15-6)5(12)2-4(11)8(13)14/h1,4H,2,11H2,(H,13,14)/t4-/m0/s1 |
| InChIKey | CWKAAENBBCKIEV-BYPYZUCNSA-N |
| XLogP | 2.04 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |