C10H12Cl2OS — CID 43344748
1-(2,5-dichlorothiophen-3-yl)-2-ethylbutan-1-one (PubChem CID 43344748) has the molecular formula C10H12Cl2OS and a molecular weight of 251.18 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-ethylbutan-1-one.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 43344748 |
| Molecular Formula | C10H12Cl2OS |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H12Cl2OS/c1-3-6(4-2)9(13)7-5-8(11)14-10(7)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | VYQWROJLWOFPJT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |