C11H14Cl2OS — CID 130871355
1-(2,5-dichlorothiophen-3-yl)-2,3,3-trimethylbutan-1-one (PubChem CID 130871355) has the molecular formula C11H14Cl2OS and a molecular weight of 265.20 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2,3,3-trimethylbutan-1-one.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2,3,3-trimethylbutan-1-one |
|---|---|
| PubChem CID | 130871355 |
| Molecular Formula | C11H14Cl2OS |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2,3,3-trimethylbutan-1-one |
| SMILES | CC(C(=O)c1cc(Cl)sc1Cl)C(C)(C)C |
| InChI | InChI=1S/C11H14Cl2OS/c1-6(11(2,3)4)9(14)7-5-8(12)15-10(7)13/h5-6H,1-4H3 |
| InChIKey | CVMLOSZXSROGFT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |