C11H14Cl3NOS — CID 106354736
2,5-dichloro-N-(1-chloro-4-methylpentan-3-yl)thiophene-3-carboxamide (PubChem CID 106354736) has the molecular formula C11H14Cl3NOS and a molecular weight of 314.67 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-chloro-4-methylpentan-3-yl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(1-chloro-4-methylpentan-3-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106354736 |
| Molecular Formula | C11H14Cl3NOS |
| Molecular Weight | 314.67 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2,5-dichloro-N-(1-chloro-4-methylpentan-3-yl)thiophene-3-carboxamide |
| SMILES | CC(C)C(CCCl)NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H14Cl3NOS/c1-6(2)8(3-4-12)15-11(16)7-5-9(13)17-10(7)14/h5-6,8H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | SOZGWRAAOYACDK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|