C13H18ClNO3 — CID 106354678
N-(1-chloro-4-methylpentan-3-yl)-2,4-dihydroxybenzamide (PubChem CID 106354678) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-2,4-dihydroxybenzamide.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 106354678 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-2,4-dihydroxybenzamide |
| SMILES | CC(C)C(CCCl)NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H18ClNO3/c1-8(2)11(5-6-14)15-13(18)10-4-3-9(16)7-12(10)17/h3-4,7-8,11,16-17H,5-6H2,1-2H3,(H,15,18) |
| InChIKey | CDBKRMNXKWEGEI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|