C15H22ClNO — CID 114177722
N-(1-chloro-4-methylpentan-3-yl)-3,4-dimethylbenzamide (PubChem CID 114177722) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-3,4-dimethylbenzamide.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 114177722 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(CCCl)C(C)C)cc1C |
| InChI | InChI=1S/C15H22ClNO/c1-10(2)14(7-8-16)17-15(18)13-6-5-11(3)12(4)9-13/h5-6,9-10,14H,7-8H2,1-4H3,(H,17,18) |
| InChIKey | WFOGIWUWCLPXOJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|