C13H16Cl2INO — CID 106354755
3-chloro-N-(1-chloro-4-methylpentan-3-yl)-4-iodobenzamide (PubChem CID 106354755) has the molecular formula C13H16Cl2INO and a molecular weight of 400.09 g/mol. Its IUPAC name is 3-chloro-N-(1-chloro-4-methylpentan-3-yl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(1-chloro-4-methylpentan-3-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 106354755 |
| Molecular Formula | C13H16Cl2INO |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 3-chloro-N-(1-chloro-4-methylpentan-3-yl)-4-iodobenzamide |
| SMILES | CC(C)C(CCCl)NC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2INO/c1-8(2)12(5-6-14)17-13(18)9-3-4-11(16)10(15)7-9/h3-4,7-8,12H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | ORQXIWJHEVQFEX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|