C12H15NO5 — CID 30117592
(2R)-2-[(2,4-dihydroxybenzoyl)amino]-3-methylbutanoic acid (PubChem CID 30117592) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is (2R)-2-[(2,4-dihydroxybenzoyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2,4-dihydroxybenzoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 30117592 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (2R)-2-[(2,4-dihydroxybenzoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C12H15NO5/c1-6(2)10(12(17)18)13-11(16)8-4-3-7(14)5-9(8)15/h3-6,10,14-15H,1-2H3,(H,13,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | ZZFSUKJRLRTRHI-SNVBAGLBSA-N |
| XLogP | 0.94 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |