C12H13NO7 — CID 63303631
(2S)-2-[(2,4-dihydroxybenzoyl)amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63303631) has the molecular formula C12H13NO7 and a molecular weight of 283.24 g/mol. Its IUPAC name is (2S)-2-[(2,4-dihydroxybenzoyl)amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(2,4-dihydroxybenzoyl)amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63303631 |
| Molecular Formula | C12H13NO7 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2S)-2-[(2,4-dihydroxybenzoyl)amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)c1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C12H13NO7/c1-20-10(16)5-8(12(18)19)13-11(17)7-3-2-6(14)4-9(7)15/h2-4,8,14-15H,5H2,1H3,(H,13,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | JGGNWDIJUQPHDR-QMMMGPOBSA-N |
| XLogP | -0.16 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |