C12H15NO5S — CID 40553433
(2R)-2-[(2,4-dihydroxybenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 40553433) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is (2R)-2-[(2,4-dihydroxybenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(2,4-dihydroxybenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 40553433 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (2R)-2-[(2,4-dihydroxybenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C12H15NO5S/c1-19-5-4-9(12(17)18)13-11(16)8-3-2-7(14)6-10(8)15/h2-3,6,9,14-15H,4-5H2,1H3,(H,13,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | PXUJXZNDNWIRBB-SECBINFHSA-N |
| XLogP | 1.03 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |