C9H10Cl3NOS — CID 107966047
2,5-dichloro-N-(3-chlorobutyl)thiophene-3-carboxamide (PubChem CID 107966047) has the molecular formula C9H10Cl3NOS and a molecular weight of 286.61 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-chlorobutyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(3-chlorobutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966047 |
| Molecular Formula | C9H10Cl3NOS |
| Molecular Weight | 286.61 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | 2,5-dichloro-N-(3-chlorobutyl)thiophene-3-carboxamide |
| SMILES | CC(Cl)CCNC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H10Cl3NOS/c1-5(10)2-3-13-9(14)6-4-7(11)15-8(6)12/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | JFDFHEOQJBKTJX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|