C11H15Cl2NO2S — CID 103919609
2,5-dichloro-N-(6-hydroxyhexyl)thiophene-3-carboxamide (PubChem CID 103919609) has the molecular formula C11H15Cl2NO2S and a molecular weight of 296.22 g/mol. Its IUPAC name is 2,5-dichloro-N-(6-hydroxyhexyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(6-hydroxyhexyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103919609 |
| Molecular Formula | C11H15Cl2NO2S |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2,5-dichloro-N-(6-hydroxyhexyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCCCCCO)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H15Cl2NO2S/c12-9-7-8(10(13)17-9)11(16)14-5-3-1-2-4-6-15/h7,15H,1-6H2,(H,14,16) |
| InChIKey | CBDXVDNVZZXWDL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|