C8H9Cl2N3O2S — CID 107965178
N-[(3E)-3-amino-3-hydroxyiminopropyl]-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107965178) has the molecular formula C8H9Cl2N3O2S and a molecular weight of 282.15 g/mol. Its IUPAC name is N-[(3E)-3-amino-3-hydroxyiminopropyl]-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-[(3E)-3-amino-3-hydroxyiminopropyl]-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965178 |
| Molecular Formula | C8H9Cl2N3O2S |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | N-[(3E)-3-amino-3-hydroxyiminopropyl]-2,5-dichlorothiophene-3-carboxamide |
| SMILES | N/C(CCNC(=O)c1cc(Cl)sc1Cl)=N/O |
| InChI | InChI=1S/C8H9Cl2N3O2S/c9-5-3-4(7(10)16-5)8(14)12-2-1-6(11)13-15/h3,15H,1-2H2,(H2,11,13)(H,12,14) |
| InChIKey | XLQWBAGCQPGMFZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|