C13H19N3O5 — CID 76948222
N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethoxybenzamide (PubChem CID 76948222) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 76948222 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)NCCC(N)=NO)cc1OC |
| InChI | InChI=1S/C13H19N3O5/c1-19-9-7-11(21-3)10(20-2)6-8(9)13(17)15-5-4-12(14)16-18/h6-7,18H,4-5H2,1-3H3,(H2,14,16)(H,15,17) |
| InChIKey | WNLXATAKFRQYJZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|