C13H18N4O4 — CID 61344554
N-(3-azidopropyl)-2,4,5-trimethoxybenzamide (PubChem CID 61344554) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-(3-azidopropyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(3-azidopropyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 61344554 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-(3-azidopropyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)NCCCN=[N+]=[N-])cc1OC |
| InChI | InChI=1S/C13H18N4O4/c1-19-10-8-12(21-3)11(20-2)7-9(10)13(18)15-5-4-6-16-17-14/h7-8H,4-6H2,1-3H3,(H,15,18) |
| InChIKey | KQWZRJZQOHXXMW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|