C10H10F3N3O3 — CID 76948281
N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 76948281) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 76948281 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | NC(CCNC(=O)c1cc(F)c(F)c(O)c1F)=NO |
| InChI | InChI=1S/C10H10F3N3O3/c11-5-3-4(7(12)9(17)8(5)13)10(18)15-2-1-6(14)16-19/h3,17,19H,1-2H2,(H2,14,16)(H,15,18) |
| InChIKey | MWRVIUMYVSQXFN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|