C11H12F3N3O3 — CID 76934546
N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 76934546) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 76934546 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CC(CC(N)=NO)NC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C11H12F3N3O3/c1-4(2-7(15)17-20)16-11(19)5-3-6(12)9(14)10(18)8(5)13/h3-4,18,20H,2H2,1H3,(H2,15,17)(H,16,19) |
| InChIKey | KWRFBDMAZQGTDQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|