C11H10F3NO4 — CID 43469590
2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid (PubChem CID 43469590) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid.
| Compound Name | 2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43469590 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)c1cc(F)c(F)c(O)c1F)C(=O)O |
| InChI | InChI=1S/C11H10F3NO4/c1-2-6(11(18)19)15-10(17)4-3-5(12)8(14)9(16)7(4)13/h3,6,16H,2H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | UAHQSTUYNIZMEB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|