C11H10F2N2O5 — CID 107121611
(2R)-2-[(2,5-difluoro-3-nitrobenzoyl)amino]butanoic acid (PubChem CID 107121611) has the molecular formula C11H10F2N2O5 and a molecular weight of 288.21 g/mol. Its IUPAC name is (2R)-2-[(2,5-difluoro-3-nitrobenzoyl)amino]butanoic acid.
| Compound Name | (2R)-2-[(2,5-difluoro-3-nitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107121611 |
| Molecular Formula | C11H10F2N2O5 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (2R)-2-[(2,5-difluoro-3-nitrobenzoyl)amino]butanoic acid |
| SMILES | CC[C@@H](NC(=O)c1cc(F)cc([N+](=O)[O-])c1F)C(=O)O |
| InChI | InChI=1S/C11H10F2N2O5/c1-2-7(11(17)18)14-10(16)6-3-5(12)4-8(9(6)13)15(19)20/h3-4,7H,2H2,1H3,(H,14,16)(H,17,18)/t7-/m1/s1 |
| InChIKey | UZGGWHDBLGGSAW-SSDOTTSWSA-N |
| XLogP | 1.47 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|