C11H13F2N3O3 — CID 107122653
N-(1-aminobutan-2-yl)-2,5-difluoro-3-nitrobenzamide (PubChem CID 107122653) has the molecular formula C11H13F2N3O3 and a molecular weight of 273.24 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-2,5-difluoro-3-nitrobenzamide.
| Compound Name | N-(1-aminobutan-2-yl)-2,5-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107122653 |
| Molecular Formula | C11H13F2N3O3 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(1-aminobutan-2-yl)-2,5-difluoro-3-nitrobenzamide |
| SMILES | CCC(CN)NC(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C11H13F2N3O3/c1-2-7(5-14)15-11(17)8-3-6(12)4-9(10(8)13)16(18)19/h3-4,7H,2,5,14H2,1H3,(H,15,17) |
| InChIKey | NVSZQHQXDKREPH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|