C9H9F2N3O3 — CID 107121636
N-(2-aminoethyl)-2,5-difluoro-3-nitrobenzamide (PubChem CID 107121636) has the molecular formula C9H9F2N3O3 and a molecular weight of 245.18 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,5-difluoro-3-nitrobenzamide.
| Compound Name | N-(2-aminoethyl)-2,5-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107121636 |
| Molecular Formula | C9H9F2N3O3 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-(2-aminoethyl)-2,5-difluoro-3-nitrobenzamide |
| SMILES | NCCNC(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H9F2N3O3/c10-5-3-6(9(15)13-2-1-12)8(11)7(4-5)14(16)17/h3-4H,1-2,12H2,(H,13,15) |
| InChIKey | UOZRWAYSGLQBEL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|