C13H14F2N2O4 — CID 107122076
2,5-difluoro-3-nitro-N-(oxan-4-ylmethyl)benzamide (PubChem CID 107122076) has the molecular formula C13H14F2N2O4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2,5-difluoro-3-nitro-N-(oxan-4-ylmethyl)benzamide.
| Compound Name | 2,5-difluoro-3-nitro-N-(oxan-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107122076 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2,5-difluoro-3-nitro-N-(oxan-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCOCC1)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C13H14F2N2O4/c14-9-5-10(12(15)11(6-9)17(19)20)13(18)16-7-8-1-3-21-4-2-8/h5-6,8H,1-4,7H2,(H,16,18) |
| InChIKey | WZQAWGZJRDKHDI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|